C16H20N4O2 — CID 82592276
3-[4-amino-3-(3-aminophenyl)-4,5,6,7-tetrahydroindazol-1-yl]propanoic acid (PubChem CID 82592276) has the molecular formula C16H20N4O2 and a molecular weight of 300.36 g/mol. Its IUPAC name is 3-[4-amino-3-(3-aminophenyl)-4,5,6,7-tetrahydroindazol-1-yl]propanoic acid.
| Compound Name | 3-[4-amino-3-(3-aminophenyl)-4,5,6,7-tetrahydroindazol-1-yl]propanoic acid |
|---|---|
| PubChem CID | 82592276 |
| Molecular Formula | C16H20N4O2 |
| Molecular Weight | 300.36 g/mol |
| Exact Mass | 300.16 |
| IUPAC Name | 3-[4-amino-3-(3-aminophenyl)-4,5,6,7-tetrahydroindazol-1-yl]propanoic acid |
| SMILES | Nc1cccc(-c2nn(CCC(=O)O)c3c2C(N)CCC3)c1 |
| InChI | InChI=1S/C16H20N4O2/c17-11-4-1-3-10(9-11)16-15-12(18)5-2-6-13(15)20(19-16)8-7-14(21)22/h1,3-4,9,12H,2,5-8,17-18H2,(H,21,22) |
| InChIKey | ZSGHCUSQHXAYFC-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 107.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.36 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|