C16H19N5 — CID 82592450
3-[4-amino-3-(3-aminophenyl)-4,5,6,7-tetrahydroindazol-1-yl]propanenitrile (PubChem CID 82592450) has the molecular formula C16H19N5 and a molecular weight of 281.36 g/mol. Its IUPAC name is 3-[4-amino-3-(3-aminophenyl)-4,5,6,7-tetrahydroindazol-1-yl]propanenitrile.
| Compound Name | 3-[4-amino-3-(3-aminophenyl)-4,5,6,7-tetrahydroindazol-1-yl]propanenitrile |
|---|---|
| PubChem CID | 82592450 |
| Molecular Formula | C16H19N5 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.16 |
| IUPAC Name | 3-[4-amino-3-(3-aminophenyl)-4,5,6,7-tetrahydroindazol-1-yl]propanenitrile |
| SMILES | N#CCCn1nc(-c2cccc(N)c2)c2c1CCCC2N |
| InChI | InChI=1S/C16H19N5/c17-8-3-9-21-14-7-2-6-13(19)15(14)16(20-21)11-4-1-5-12(18)10-11/h1,4-5,10,13H,2-3,6-7,9,18-19H2 |
| InChIKey | OMWRBLFJKDIBOZ-UHFFFAOYSA-N |
| XLogP | 2.38 |
| TPSA | 93.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 2.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|