C14H14F3N3 — CID 82592484
1-phenyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-4-amine (PubChem CID 82592484) has the molecular formula C14H14F3N3 and a molecular weight of 281.28 g/mol. Its IUPAC name is 1-phenyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-4-amine.
| Compound Name | 1-phenyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-4-amine |
|---|---|
| PubChem CID | 82592484 |
| Molecular Formula | C14H14F3N3 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.11 |
| IUPAC Name | 1-phenyl-3-(trifluoromethyl)-4,5,6,7-tetrahydroindazol-4-amine |
| SMILES | NC1CCCc2c1c(C(F)(F)F)nn2-c1ccccc1 |
| InChI | InChI=1S/C14H14F3N3/c15-14(16,17)13-12-10(18)7-4-8-11(12)20(19-13)9-5-2-1-3-6-9/h1-3,5-6,10H,4,7-8,18H2 |
| InChIKey | ZRMHBUADKAZMPU-UHFFFAOYSA-N |
| XLogP | 3.23 |
| TPSA | 43.84 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |