C17H16ClN5O2 — CID 82593518
2-[2-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)ethyl]isoindole-1,3-dione;hydrochloride (PubChem CID 82593518) has the molecular formula C17H16ClN5O2 and a molecular weight of 357.80 g/mol. Its IUPAC name is 2-[2-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)ethyl]isoindole-1,3-dione;hydrochloride.
| Compound Name | 2-[2-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)ethyl]isoindole-1,3-dione;hydrochloride |
|---|---|
| PubChem CID | 82593518 |
| Molecular Formula | C17H16ClN5O2 |
| Molecular Weight | 357.80 g/mol |
| Exact Mass | 357.10 |
| IUPAC Name | 2-[2-(5,7-dimethyl-[1,2,4]triazolo[4,3-a]pyrimidin-3-yl)ethyl]isoindole-1,3-dione;hydrochloride |
| SMILES | Cc1cc(C)n2c(CCN3C(=O)c4ccccc4C3=O)nnc2n1.Cl |
| InChI | InChI=1S/C17H15N5O2.ClH/c1-10-9-11(2)22-14(19-20-17(22)18-10)7-8-21-15(23)12-5-3-4-6-13(12)16(21)24;/h3-6,9H,7-8H2,1-2H3;1H |
| InChIKey | ROXQMURMSOUNRI-UHFFFAOYSA-N |
| XLogP | 2.00 |
| TPSA | 80.46 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.80 |
| LogP ≤ 5 | 2.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|