About 2-amino-2-(1,2-oxazol-3-yl)ethanol
2-amino-2-(1,2-oxazol-3-yl)ethanol (PubChem CID 82593730) has the molecular formula C5H8N2O2
and a molecular weight of 128.13 g/mol. Its IUPAC name is 2-amino-2-(1,2-oxazol-3-yl)ethanol.
Molecular Properties
| Compound Name | 2-amino-2-(1,2-oxazol-3-yl)ethanol |
| PubChem CID | 82593730 |
| Molecular Formula | C5H8N2O2 |
| Molecular Weight | 128.13 g/mol |
| Exact Mass | 128.06 |
| IUPAC Name | 2-amino-2-(1,2-oxazol-3-yl)ethanol |
| SMILES | NC(CO)c1ccon1 |
| InChI | InChI=1S/C5H8N2O2/c6-4(3-8)5-1-2-9-7-5/h1-2,4,8H,3,6H2 |
| InChIKey | MDOVTXSYCQLPTA-UHFFFAOYSA-N |
| XLogP | -0.33 |
| TPSA | 72.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 128.13 |
| LogP ≤ 5 | -0.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-amino-2-(1,2-oxazol-3-yl)ethanol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-amino-2-(1,2-oxazol-3-yl)ethanol?
The IUPAC name of 2-amino-2-(1,2-oxazol-3-yl)ethanol (CID 82593730) is 2-amino-2-(1,2-oxazol-3-yl)ethanol.
What is the SMILES notation for 2-amino-2-(1,2-oxazol-3-yl)ethanol?
The canonical SMILES for 2-amino-2-(1,2-oxazol-3-yl)ethanol is NC(CO)c1ccon1.
What is the InChIKey of 2-amino-2-(1,2-oxazol-3-yl)ethanol?
The InChIKey is MDOVTXSYCQLPTA-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H8N2O2/c6-4(3-8)5-1-2-9-7-5/h1-2,4,8H,3,6H2.
What are the key properties of 2-amino-2-(1,2-oxazol-3-yl)ethanol?
2-amino-2-(1,2-oxazol-3-yl)ethanol has a molecular weight of 128.13 g/mol, XLogP of -0.33, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-amino-2-(1,2-oxazol-3-yl)ethanol is sourced from PubChem (CID 82593730), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).