About 5,5-dimethylazepan-3-one
5,5-dimethylazepan-3-one (PubChem CID 82594303) has the molecular formula C8H15NO
and a molecular weight of 141.21 g/mol. Its IUPAC name is 5,5-dimethylazepan-3-one.
Molecular Properties
| Compound Name | 5,5-dimethylazepan-3-one |
| PubChem CID | 82594303 |
| Molecular Formula | C8H15NO |
| Molecular Weight | 141.21 g/mol |
| Exact Mass | 141.12 |
| IUPAC Name | 5,5-dimethylazepan-3-one |
| SMILES | CC1(C)CCNCC(=O)C1 |
| InChI | InChI=1S/C8H15NO/c1-8(2)3-4-9-6-7(10)5-8/h9H,3-6H2,1-2H3 |
| InChIKey | WHJCAIZTEZPQEY-UHFFFAOYSA-N |
| XLogP | 0.97 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 141.21 |
| LogP ≤ 5 | 0.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 5,5-dimethylazepan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dimethylazepan-3-one?
The IUPAC name of 5,5-dimethylazepan-3-one (CID 82594303) is 5,5-dimethylazepan-3-one.
What is the SMILES notation for 5,5-dimethylazepan-3-one?
The canonical SMILES for 5,5-dimethylazepan-3-one is CC1(C)CCNCC(=O)C1.
What is the InChIKey of 5,5-dimethylazepan-3-one?
The InChIKey is WHJCAIZTEZPQEY-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO/c1-8(2)3-4-9-6-7(10)5-8/h9H,3-6H2,1-2H3.
What are the key properties of 5,5-dimethylazepan-3-one?
5,5-dimethylazepan-3-one has a molecular weight of 141.21 g/mol, XLogP of 0.97, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dimethylazepan-3-one is sourced from PubChem (CID 82594303), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).