About 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine
2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine (PubChem CID 82594672) has the molecular formula C6H7N5
and a molecular weight of 149.16 g/mol. Its IUPAC name is 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine.
Molecular Properties
| Compound Name | 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine |
| PubChem CID | 82594672 |
| Molecular Formula | C6H7N5 |
| Molecular Weight | 149.16 g/mol |
| Exact Mass | 149.07 |
| IUPAC Name | 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine |
| SMILES | NCc1[nH]nc2cncnc12 |
| InChI | InChI=1S/C6H7N5/c7-1-4-6-5(11-10-4)2-8-3-9-6/h2-3H,1,7H2,(H,10,11) |
| InChIKey | WFAQLFWTCARWEE-UHFFFAOYSA-N |
| XLogP | -0.19 |
| TPSA | 80.48 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.16 |
| LogP ≤ 5 | -0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine?
The IUPAC name of 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine (CID 82594672) is 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine.
What is the SMILES notation for 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine?
The canonical SMILES for 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine is NCc1[nH]nc2cncnc12.
What is the InChIKey of 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine?
The InChIKey is WFAQLFWTCARWEE-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7N5/c7-1-4-6-5(11-10-4)2-8-3-9-6/h2-3H,1,7H2,(H,10,11).
What are the key properties of 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine?
2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine has a molecular weight of 149.16 g/mol, XLogP of -0.19, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2H-pyrazolo[4,3-d]pyrimidin-3-ylmethanamine is sourced from PubChem (CID 82594672), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).