About 3-(1,2-thiazol-4-yl)propanoic acid
3-(1,2-thiazol-4-yl)propanoic acid (PubChem CID 82595969) has the molecular formula C6H7NO2S
and a molecular weight of 157.19 g/mol. Its IUPAC name is 3-(1,2-thiazol-4-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-(1,2-thiazol-4-yl)propanoic acid |
| PubChem CID | 82595969 |
| Molecular Formula | C6H7NO2S |
| Molecular Weight | 157.19 g/mol |
| Exact Mass | 157.02 |
| IUPAC Name | 3-(1,2-thiazol-4-yl)propanoic acid |
| SMILES | O=C(O)CCc1cnsc1 |
| InChI | InChI=1S/C6H7NO2S/c8-6(9)2-1-5-3-7-10-4-5/h3-4H,1-2H2,(H,8,9) |
| InChIKey | LOEWHGJWSMLQFW-UHFFFAOYSA-N |
| XLogP | 1.16 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 157.19 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 3-(1,2-thiazol-4-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1,2-thiazol-4-yl)propanoic acid?
The IUPAC name of 3-(1,2-thiazol-4-yl)propanoic acid (CID 82595969) is 3-(1,2-thiazol-4-yl)propanoic acid.
What is the SMILES notation for 3-(1,2-thiazol-4-yl)propanoic acid?
The canonical SMILES for 3-(1,2-thiazol-4-yl)propanoic acid is O=C(O)CCc1cnsc1.
What is the InChIKey of 3-(1,2-thiazol-4-yl)propanoic acid?
The InChIKey is LOEWHGJWSMLQFW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H7NO2S/c8-6(9)2-1-5-3-7-10-4-5/h3-4H,1-2H2,(H,8,9).
What are the key properties of 3-(1,2-thiazol-4-yl)propanoic acid?
3-(1,2-thiazol-4-yl)propanoic acid has a molecular weight of 157.19 g/mol, XLogP of 1.16, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1,2-thiazol-4-yl)propanoic acid is sourced from PubChem (CID 82595969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).