C8H10N4 — CID 82596319
(1-methylpyrazolo[4,5-c]pyridin-6-yl)methanamine (PubChem CID 82596319) has the molecular formula C8H10N4 and a molecular weight of 162.20 g/mol. Its IUPAC name is (1-methylpyrazolo[4,5-c]pyridin-6-yl)methanamine.
| Compound Name | (1-methylpyrazolo[4,5-c]pyridin-6-yl)methanamine |
|---|---|
| PubChem CID | 82596319 |
| Molecular Formula | C8H10N4 |
| Molecular Weight | 162.20 g/mol |
| Exact Mass | 162.09 |
| IUPAC Name | (1-methylpyrazolo[4,5-c]pyridin-6-yl)methanamine |
| SMILES | Cn1ncc2cnc(CN)cc21 |
| InChI | InChI=1S/C8H10N4/c1-12-8-2-7(3-9)10-4-6(8)5-11-12/h2,4-5H,3,9H2,1H3 |
| InChIKey | FYHWBABXTJBUTD-UHFFFAOYSA-N |
| XLogP | 0.43 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 162.20 |
| LogP ≤ 5 | 0.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |