About [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine
[1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine (PubChem CID 82597229) has the molecular formula C8H14N4
and a molecular weight of 166.23 g/mol. Its IUPAC name is [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine.
Molecular Properties
| Compound Name | [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine |
| PubChem CID | 82597229 |
| Molecular Formula | C8H14N4 |
| Molecular Weight | 166.23 g/mol |
| Exact Mass | 166.12 |
| IUPAC Name | [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine |
| SMILES | Cn1cnnc1C1(CN)CCC1 |
| InChI | InChI=1S/C8H14N4/c1-12-6-10-11-7(12)8(5-9)3-2-4-8/h6H,2-5,9H2,1H3 |
| InChIKey | WRCDCSREXLSZEV-UHFFFAOYSA-N |
| XLogP | 0.20 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 166.23 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine?
The IUPAC name of [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine (CID 82597229) is [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine.
What is the SMILES notation for [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine?
The canonical SMILES for [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine is Cn1cnnc1C1(CN)CCC1.
What is the InChIKey of [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine?
The InChIKey is WRCDCSREXLSZEV-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H14N4/c1-12-6-10-11-7(12)8(5-9)3-2-4-8/h6H,2-5,9H2,1H3.
What are the key properties of [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine?
[1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine has a molecular weight of 166.23 g/mol, XLogP of 0.20, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for [1-(4-methyl-1,2,4-triazol-3-yl)cyclobutyl]methanamine is sourced from PubChem (CID 82597229), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).