About 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid
1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid (PubChem CID 82597267) has the molecular formula C8H9NO3
and a molecular weight of 167.16 g/mol. Its IUPAC name is 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid.
Molecular Properties
| Compound Name | 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid |
| PubChem CID | 82597267 |
| Molecular Formula | C8H9NO3 |
| Molecular Weight | 167.16 g/mol |
| Exact Mass | 167.06 |
| IUPAC Name | 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid |
| SMILES | O=C(O)C1(c2ncco2)CCC1 |
| InChI | InChI=1S/C8H9NO3/c10-7(11)8(2-1-3-8)6-9-4-5-12-6/h4-5H,1-3H2,(H,10,11) |
| InChIKey | IMEYRLBZGVGHAW-UHFFFAOYSA-N |
| XLogP | 1.18 |
| TPSA | 63.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.16 |
| LogP ≤ 5 | 1.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid?
The IUPAC name of 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid (CID 82597267) is 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid.
What is the SMILES notation for 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid?
The canonical SMILES for 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid is O=C(O)C1(c2ncco2)CCC1.
What is the InChIKey of 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid?
The InChIKey is IMEYRLBZGVGHAW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H9NO3/c10-7(11)8(2-1-3-8)6-9-4-5-12-6/h4-5H,1-3H2,(H,10,11).
What are the key properties of 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid?
1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid has a molecular weight of 167.16 g/mol, XLogP of 1.18, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1,3-oxazol-2-yl)cyclobutane-1-carboxylic acid is sourced from PubChem (CID 82597267), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).