About 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one
4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one (PubChem CID 82597832) has the molecular formula C7H5ClN2O
and a molecular weight of 168.58 g/mol. Its IUPAC name is 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one.
Molecular Properties
| Compound Name | 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one |
| PubChem CID | 82597832 |
| Molecular Formula | C7H5ClN2O |
| Molecular Weight | 168.58 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one |
| SMILES | O=C1NCc2c1ccnc2Cl |
| InChI | InChI=1S/C7H5ClN2O/c8-6-5-3-10-7(11)4(5)1-2-9-6/h1-2H,3H2,(H,10,11) |
| InChIKey | GEQCNYGKEAREBK-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 41.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 168.58 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one?
The IUPAC name of 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one (CID 82597832) is 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one.
What is the SMILES notation for 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one?
The canonical SMILES for 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one is O=C1NCc2c1ccnc2Cl.
What is the InChIKey of 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one?
The InChIKey is GEQCNYGKEAREBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H5ClN2O/c8-6-5-3-10-7(11)4(5)1-2-9-6/h1-2H,3H2,(H,10,11).
What are the key properties of 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one?
4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one has a molecular weight of 168.58 g/mol, XLogP of 0.98, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-chloro-2,3-dihydropyrrolo[3,4-c]pyridin-1-one is sourced from PubChem (CID 82597832), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).