About 4-amino-3-(1,3-oxazol-5-yl)butanoic acid
4-amino-3-(1,3-oxazol-5-yl)butanoic acid (PubChem CID 82598142) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is 4-amino-3-(1,3-oxazol-5-yl)butanoic acid.
Molecular Properties
| Compound Name | 4-amino-3-(1,3-oxazol-5-yl)butanoic acid |
| PubChem CID | 82598142 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | 4-amino-3-(1,3-oxazol-5-yl)butanoic acid |
| SMILES | NCC(CC(=O)O)c1cnco1 |
| InChI | InChI=1S/C7H10N2O3/c8-2-5(1-7(10)11)6-3-9-4-12-6/h3-5H,1-2,8H2,(H,10,11) |
| InChIKey | FEHHCVJQFSJZPS-UHFFFAOYSA-N |
| XLogP | 0.19 |
| TPSA | 89.35 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 4-amino-3-(1,3-oxazol-5-yl)butanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-3-(1,3-oxazol-5-yl)butanoic acid?
The IUPAC name of 4-amino-3-(1,3-oxazol-5-yl)butanoic acid (CID 82598142) is 4-amino-3-(1,3-oxazol-5-yl)butanoic acid.
What is the SMILES notation for 4-amino-3-(1,3-oxazol-5-yl)butanoic acid?
The canonical SMILES for 4-amino-3-(1,3-oxazol-5-yl)butanoic acid is NCC(CC(=O)O)c1cnco1.
What is the InChIKey of 4-amino-3-(1,3-oxazol-5-yl)butanoic acid?
The InChIKey is FEHHCVJQFSJZPS-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c8-2-5(1-7(10)11)6-3-9-4-12-6/h3-5H,1-2,8H2,(H,10,11).
What are the key properties of 4-amino-3-(1,3-oxazol-5-yl)butanoic acid?
4-amino-3-(1,3-oxazol-5-yl)butanoic acid has a molecular weight of 170.17 g/mol, XLogP of 0.19, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-3-(1,3-oxazol-5-yl)butanoic acid is sourced from PubChem (CID 82598142), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).