C7H12N2OS — CID 82598532
2-(2-methoxy-1,3-thiazol-4-yl)propan-1-amine (PubChem CID 82598532) has the molecular formula C7H12N2OS and a molecular weight of 172.25 g/mol. Its IUPAC name is 2-(2-methoxy-1,3-thiazol-4-yl)propan-1-amine.
| Compound Name | 2-(2-methoxy-1,3-thiazol-4-yl)propan-1-amine |
|---|---|
| PubChem CID | 82598532 |
| Molecular Formula | C7H12N2OS |
| Molecular Weight | 172.25 g/mol |
| Exact Mass | 172.07 |
| IUPAC Name | 2-(2-methoxy-1,3-thiazol-4-yl)propan-1-amine |
| SMILES | COc1nc(C(C)CN)cs1 |
| InChI | InChI=1S/C7H12N2OS/c1-5(3-8)6-4-11-7(9-6)10-2/h4-5H,3,8H2,1-2H3 |
| InChIKey | LIOYONDJUBCBJK-UHFFFAOYSA-N |
| XLogP | 1.21 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 172.25 |
| LogP ≤ 5 | 1.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |