C11H12O2 — CID 82599043
1-(3,4-dihydro-2H-chromen-8-yl)ethanone (PubChem CID 82599043) has the molecular formula C11H12O2 and a molecular weight of 176.22 g/mol. Its IUPAC name is 1-(3,4-dihydro-2H-chromen-8-yl)ethanone.
| Compound Name | 1-(3,4-dihydro-2H-chromen-8-yl)ethanone |
|---|---|
| PubChem CID | 82599043 |
| Molecular Formula | C11H12O2 |
| Molecular Weight | 176.22 g/mol |
| Exact Mass | 176.08 |
| IUPAC Name | 1-(3,4-dihydro-2H-chromen-8-yl)ethanone |
| SMILES | CC(=O)c1cccc2c1OCCC2 |
| InChI | InChI=1S/C11H12O2/c1-8(12)10-6-2-4-9-5-3-7-13-11(9)10/h2,4,6H,3,5,7H2,1H3 |
| InChIKey | QJTRQFYWMJKHJH-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 176.22 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |