C10H16N2O — CID 82600698
N-methoxy-1-(5-methyl-1,4,5,6-tetrahydrocyclopenta[b]pyrrol-3-yl)methanamine (PubChem CID 82600698) has the molecular formula C10H16N2O and a molecular weight of 180.25 g/mol. Its IUPAC name is N-methoxy-1-(5-methyl-1,4,5,6-tetrahydrocyclopenta[b]pyrrol-3-yl)methanamine.
| Compound Name | N-methoxy-1-(5-methyl-1,4,5,6-tetrahydrocyclopenta[b]pyrrol-3-yl)methanamine |
|---|---|
| PubChem CID | 82600698 |
| Molecular Formula | C10H16N2O |
| Molecular Weight | 180.25 g/mol |
| Exact Mass | 180.13 |
| IUPAC Name | N-methoxy-1-(5-methyl-1,4,5,6-tetrahydrocyclopenta[b]pyrrol-3-yl)methanamine |
| SMILES | CONCc1c[nH]c2c1CC(C)C2 |
| InChI | InChI=1S/C10H16N2O/c1-7-3-9-8(6-12-13-2)5-11-10(9)4-7/h5,7,11-12H,3-4,6H2,1-2H3 |
| InChIKey | FQXXYWZTMTXQAL-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 37.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.25 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|