1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid

C8H11N3O2 — CID 82600869

IUPAC1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid
SMILESCn1nnc2c1CCC(C(=O)O)C2
InChIInChI=1S/C8H11N3O2/c1-11-7-3-2-5(8(12)13)4-6(7)9-10-11/h5H,2-4H2,1H3,(H,12,13)
InChIKeyUGMBXLDLBFZJCW-UHFFFAOYSA-N
MW181.19 g/mol
LogP0.00
Rot. Bonds1

About 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid

1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid (PubChem CID 82600869) has the molecular formula C8H11N3O2 and a molecular weight of 181.19 g/mol. Its IUPAC name is 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid.

Molecular Properties

Compound Name1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid
PubChem CID82600869
Molecular FormulaC8H11N3O2
Molecular Weight181.19 g/mol
Exact Mass181.09
IUPAC Name1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid
SMILESCn1nnc2c1CCC(C(=O)O)C2
InChIInChI=1S/C8H11N3O2/c1-11-7-3-2-5(8(12)13)4-6(7)9-10-11/h5H,2-4H2,1H3,(H,12,13)
InChIKeyUGMBXLDLBFZJCW-UHFFFAOYSA-N
XLogP0.00
TPSA68.01 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500181.19
LogP ≤ 50.00
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid?
The IUPAC name of 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid (CID 82600869) is 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid.
What is the SMILES notation for 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid?
The canonical SMILES for 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid is Cn1nnc2c1CCC(C(=O)O)C2.
What is the InChIKey of 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid?
The InChIKey is UGMBXLDLBFZJCW-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H11N3O2/c1-11-7-3-2-5(8(12)13)4-6(7)9-10-11/h5H,2-4H2,1H3,(H,12,13).
What are the key properties of 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid?
1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid has a molecular weight of 181.19 g/mol, XLogP of 0.00, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-4,5,6,7-tetrahydrobenzotriazole-5-carboxylic acid is sourced from PubChem (CID 82600869), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).