1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid

C8H10N2O3 — CID 82601243

IUPAC1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid
SMILESCn1nc(C(=O)O)c2c1CCOC2
InChIInChI=1S/C8H10N2O3/c1-10-6-2-3-13-4-5(6)7(9-10)8(11)12/h2-4H2,1H3,(H,11,12)
InChIKeyYYVSBSPRSDGNTI-UHFFFAOYSA-N
MW182.18 g/mol
LogP0.19
Rot. Bonds1

About 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid

1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid (PubChem CID 82601243) has the molecular formula C8H10N2O3 and a molecular weight of 182.18 g/mol. Its IUPAC name is 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid.

Molecular Properties

Compound Name1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid
PubChem CID82601243
Molecular FormulaC8H10N2O3
Molecular Weight182.18 g/mol
Exact Mass182.07
IUPAC Name1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid
SMILESCn1nc(C(=O)O)c2c1CCOC2
InChIInChI=1S/C8H10N2O3/c1-10-6-2-3-13-4-5(6)7(9-10)8(11)12/h2-4H2,1H3,(H,11,12)
InChIKeyYYVSBSPRSDGNTI-UHFFFAOYSA-N
XLogP0.19
TPSA64.35 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds1
Heavy Atoms13
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500182.18
LogP ≤ 50.19
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid?
The IUPAC name of 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid (CID 82601243) is 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid.
What is the SMILES notation for 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid?
The canonical SMILES for 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid is Cn1nc(C(=O)O)c2c1CCOC2.
What is the InChIKey of 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid?
The InChIKey is YYVSBSPRSDGNTI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H10N2O3/c1-10-6-2-3-13-4-5(6)7(9-10)8(11)12/h2-4H2,1H3,(H,11,12).
What are the key properties of 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid?
1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid has a molecular weight of 182.18 g/mol, XLogP of 0.19, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-6,7-dihydro-4H-pyrano[4,3-c]pyrazole-3-carboxylic acid is sourced from PubChem (CID 82601243), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).