About 2-cyclohexyl-1,4-oxazepane
2-cyclohexyl-1,4-oxazepane (PubChem CID 82601829) has the molecular formula C11H21NO
and a molecular weight of 183.29 g/mol. Its IUPAC name is 2-cyclohexyl-1,4-oxazepane.
Molecular Properties
| Compound Name | 2-cyclohexyl-1,4-oxazepane |
| PubChem CID | 82601829 |
| Molecular Formula | C11H21NO |
| Molecular Weight | 183.29 g/mol |
| Exact Mass | 183.16 |
| IUPAC Name | 2-cyclohexyl-1,4-oxazepane |
| SMILES | C1CCC(C2CNCCCO2)CC1 |
| InChI | InChI=1S/C11H21NO/c1-2-5-10(6-3-1)11-9-12-7-4-8-13-11/h10-12H,1-9H2 |
| InChIKey | HAARUDSVNMVQRU-UHFFFAOYSA-N |
| XLogP | 1.95 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 183.29 |
| LogP ≤ 5 | 1.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 2-cyclohexyl-1,4-oxazepane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-cyclohexyl-1,4-oxazepane?
The IUPAC name of 2-cyclohexyl-1,4-oxazepane (CID 82601829) is 2-cyclohexyl-1,4-oxazepane.
What is the SMILES notation for 2-cyclohexyl-1,4-oxazepane?
The canonical SMILES for 2-cyclohexyl-1,4-oxazepane is C1CCC(C2CNCCCO2)CC1.
What is the InChIKey of 2-cyclohexyl-1,4-oxazepane?
The InChIKey is HAARUDSVNMVQRU-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H21NO/c1-2-5-10(6-3-1)11-9-12-7-4-8-13-11/h10-12H,1-9H2.
What are the key properties of 2-cyclohexyl-1,4-oxazepane?
2-cyclohexyl-1,4-oxazepane has a molecular weight of 183.29 g/mol, XLogP of 1.95, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-cyclohexyl-1,4-oxazepane is sourced from PubChem (CID 82601829), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).