About 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol
2-(aminomethyl)thieno[3,2-b]thiophen-5-ol (PubChem CID 82602213) has the molecular formula C7H7NOS2
and a molecular weight of 185.27 g/mol. Its IUPAC name is 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol.
Molecular Properties
| Compound Name | 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol |
| PubChem CID | 82602213 |
| Molecular Formula | C7H7NOS2 |
| Molecular Weight | 185.27 g/mol |
| Exact Mass | 185.00 |
| IUPAC Name | 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol |
| SMILES | NCc1cc2sc(O)cc2s1 |
| InChI | InChI=1S/C7H7NOS2/c8-3-4-1-5-6(10-4)2-7(9)11-5/h1-2,9H,3,8H2 |
| InChIKey | UCGZCDBYUCDBHN-UHFFFAOYSA-N |
| XLogP | 2.13 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 185.27 |
| LogP ≤ 5 | 2.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol?
The IUPAC name of 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol (CID 82602213) is 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol.
What is the SMILES notation for 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol?
The canonical SMILES for 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol is NCc1cc2sc(O)cc2s1.
What is the InChIKey of 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol?
The InChIKey is UCGZCDBYUCDBHN-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7NOS2/c8-3-4-1-5-6(10-4)2-7(9)11-5/h1-2,9H,3,8H2.
What are the key properties of 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol?
2-(aminomethyl)thieno[3,2-b]thiophen-5-ol has a molecular weight of 185.27 g/mol, XLogP of 2.13, 1 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(aminomethyl)thieno[3,2-b]thiophen-5-ol is sourced from PubChem (CID 82602213), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).