About 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid
3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid (PubChem CID 82602304) has the molecular formula C7H10N2O2S
and a molecular weight of 186.24 g/mol. Its IUPAC name is 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid.
Molecular Properties
| Compound Name | 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid |
| PubChem CID | 82602304 |
| Molecular Formula | C7H10N2O2S |
| Molecular Weight | 186.24 g/mol |
| Exact Mass | 186.05 |
| IUPAC Name | 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid |
| SMILES | Cc1cnc(C(N)CC(=O)O)s1 |
| InChI | InChI=1S/C7H10N2O2S/c1-4-3-9-7(12-4)5(8)2-6(10)11/h3,5H,2,8H2,1H3,(H,10,11) |
| InChIKey | HAQIUSFFHRTCTB-UHFFFAOYSA-N |
| XLogP | 0.93 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.24 |
| LogP ≤ 5 | 0.93 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid?
The IUPAC name of 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid (CID 82602304) is 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid.
What is the SMILES notation for 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid?
The canonical SMILES for 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid is Cc1cnc(C(N)CC(=O)O)s1.
What is the InChIKey of 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid?
The InChIKey is HAQIUSFFHRTCTB-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O2S/c1-4-3-9-7(12-4)5(8)2-6(10)11/h3,5H,2,8H2,1H3,(H,10,11).
What are the key properties of 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid?
3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid has a molecular weight of 186.24 g/mol, XLogP of 0.93, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-3-(5-methyl-1,3-thiazol-2-yl)propanoic acid is sourced from PubChem (CID 82602304), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).