About 3-(1-aminocyclobutyl)-N,N-dimethylaniline
3-(1-aminocyclobutyl)-N,N-dimethylaniline (PubChem CID 82603640) has the molecular formula C12H18N2
and a molecular weight of 190.29 g/mol. Its IUPAC name is 3-(1-aminocyclobutyl)-N,N-dimethylaniline.
Molecular Properties
| Compound Name | 3-(1-aminocyclobutyl)-N,N-dimethylaniline |
| PubChem CID | 82603640 |
| Molecular Formula | C12H18N2 |
| Molecular Weight | 190.29 g/mol |
| Exact Mass | 190.15 |
| IUPAC Name | 3-(1-aminocyclobutyl)-N,N-dimethylaniline |
| SMILES | CN(C)c1cccc(C2(N)CCC2)c1 |
| InChI | InChI=1S/C12H18N2/c1-14(2)11-6-3-5-10(9-11)12(13)7-4-8-12/h3,5-6,9H,4,7-8,13H2,1-2H3 |
| InChIKey | LPWIIICITJMQHK-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 29.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 190.29 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-(1-aminocyclobutyl)-N,N-dimethylaniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-(1-aminocyclobutyl)-N,N-dimethylaniline?
The IUPAC name of 3-(1-aminocyclobutyl)-N,N-dimethylaniline (CID 82603640) is 3-(1-aminocyclobutyl)-N,N-dimethylaniline.
What is the SMILES notation for 3-(1-aminocyclobutyl)-N,N-dimethylaniline?
The canonical SMILES for 3-(1-aminocyclobutyl)-N,N-dimethylaniline is CN(C)c1cccc(C2(N)CCC2)c1.
What is the InChIKey of 3-(1-aminocyclobutyl)-N,N-dimethylaniline?
The InChIKey is LPWIIICITJMQHK-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H18N2/c1-14(2)11-6-3-5-10(9-11)12(13)7-4-8-12/h3,5-6,9H,4,7-8,13H2,1-2H3.
What are the key properties of 3-(1-aminocyclobutyl)-N,N-dimethylaniline?
3-(1-aminocyclobutyl)-N,N-dimethylaniline has a molecular weight of 190.29 g/mol, XLogP of 2.09, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-(1-aminocyclobutyl)-N,N-dimethylaniline is sourced from PubChem (CID 82603640), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).