About 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile
2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile (PubChem CID 82606014) has the molecular formula C9H7ClN2O
and a molecular weight of 194.62 g/mol. Its IUPAC name is 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile.
Molecular Properties
| Compound Name | 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile |
| PubChem CID | 82606014 |
| Molecular Formula | C9H7ClN2O |
| Molecular Weight | 194.62 g/mol |
| Exact Mass | 194.02 |
| IUPAC Name | 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile |
| SMILES | N#Cc1cc2c(nc1Cl)COCC2 |
| InChI | InChI=1S/C9H7ClN2O/c10-9-7(4-11)3-6-1-2-13-5-8(6)12-9/h3H,1-2,5H2 |
| InChIKey | QSPVYSJLJNJESN-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 194.62 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|
Analyze 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile?
The IUPAC name of 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile (CID 82606014) is 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile.
What is the SMILES notation for 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile?
The canonical SMILES for 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile is N#Cc1cc2c(nc1Cl)COCC2.
What is the InChIKey of 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile?
The InChIKey is QSPVYSJLJNJESN-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H7ClN2O/c10-9-7(4-11)3-6-1-2-13-5-8(6)12-9/h3H,1-2,5H2.
What are the key properties of 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile?
2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile has a molecular weight of 194.62 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-chloro-6,8-dihydro-5H-pyrano[3,4-b]pyridine-3-carbonitrile is sourced from PubChem (CID 82606014), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).