About 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine
8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine (PubChem CID 82606226) has the molecular formula C11H14FNO
and a molecular weight of 195.24 g/mol. Its IUPAC name is 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine.
Molecular Properties
| Compound Name | 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine |
| PubChem CID | 82606226 |
| Molecular Formula | C11H14FNO |
| Molecular Weight | 195.24 g/mol |
| Exact Mass | 195.11 |
| IUPAC Name | 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine |
| SMILES | CNC1(C)CCOc2c(F)cccc21 |
| InChI | InChI=1S/C11H14FNO/c1-11(13-2)6-7-14-10-8(11)4-3-5-9(10)12/h3-5,13H,6-7H2,1-2H3 |
| InChIKey | KCALOIAQCFMWGR-UHFFFAOYSA-N |
| XLogP | 2.04 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.24 |
| LogP ≤ 5 | 2.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine?
The IUPAC name of 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine (CID 82606226) is 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine.
What is the SMILES notation for 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine?
The canonical SMILES for 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine is CNC1(C)CCOc2c(F)cccc21.
What is the InChIKey of 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine?
The InChIKey is KCALOIAQCFMWGR-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H14FNO/c1-11(13-2)6-7-14-10-8(11)4-3-5-9(10)12/h3-5,13H,6-7H2,1-2H3.
What are the key properties of 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine?
8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine has a molecular weight of 195.24 g/mol, XLogP of 2.04, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 8-fluoro-N,4-dimethyl-2,3-dihydrochromen-4-amine is sourced from PubChem (CID 82606226), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).