About 3-cyclohexyl-4,4-dimethylpiperidine
3-cyclohexyl-4,4-dimethylpiperidine (PubChem CID 82606475) has the molecular formula C13H25N
and a molecular weight of 195.35 g/mol. Its IUPAC name is 3-cyclohexyl-4,4-dimethylpiperidine.
Molecular Properties
| Compound Name | 3-cyclohexyl-4,4-dimethylpiperidine |
| PubChem CID | 82606475 |
| Molecular Formula | C13H25N |
| Molecular Weight | 195.35 g/mol |
| Exact Mass | 195.20 |
| IUPAC Name | 3-cyclohexyl-4,4-dimethylpiperidine |
| SMILES | CC1(C)CCNCC1C1CCCCC1 |
| InChI | InChI=1S/C13H25N/c1-13(2)8-9-14-10-12(13)11-6-4-3-5-7-11/h11-12,14H,3-10H2,1-2H3 |
| InChIKey | MVGQZRLFRPOPLZ-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 195.35 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 3-cyclohexyl-4,4-dimethylpiperidine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-cyclohexyl-4,4-dimethylpiperidine?
The IUPAC name of 3-cyclohexyl-4,4-dimethylpiperidine (CID 82606475) is 3-cyclohexyl-4,4-dimethylpiperidine.
What is the SMILES notation for 3-cyclohexyl-4,4-dimethylpiperidine?
The canonical SMILES for 3-cyclohexyl-4,4-dimethylpiperidine is CC1(C)CCNCC1C1CCCCC1.
What is the InChIKey of 3-cyclohexyl-4,4-dimethylpiperidine?
The InChIKey is MVGQZRLFRPOPLZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H25N/c1-13(2)8-9-14-10-12(13)11-6-4-3-5-7-11/h11-12,14H,3-10H2,1-2H3.
What are the key properties of 3-cyclohexyl-4,4-dimethylpiperidine?
3-cyclohexyl-4,4-dimethylpiperidine has a molecular weight of 195.35 g/mol, XLogP of 3.20, 1 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3-cyclohexyl-4,4-dimethylpiperidine is sourced from PubChem (CID 82606475), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).