C12H15N3 — CID 82607892
[1-(3H-benzimidazol-5-yl)cyclobutyl]methanamine (PubChem CID 82607892) has the molecular formula C12H15N3 and a molecular weight of 201.27 g/mol. Its IUPAC name is [1-(3H-benzimidazol-5-yl)cyclobutyl]methanamine.
| Compound Name | [1-(3H-benzimidazol-5-yl)cyclobutyl]methanamine |
|---|---|
| PubChem CID | 82607892 |
| Molecular Formula | C12H15N3 |
| Molecular Weight | 201.27 g/mol |
| Exact Mass | 201.13 |
| IUPAC Name | [1-(3H-benzimidazol-5-yl)cyclobutyl]methanamine |
| SMILES | NCC1(c2ccc3nc[nH]c3c2)CCC1 |
| InChI | InChI=1S/C12H15N3/c13-7-12(4-1-5-12)9-2-3-10-11(6-9)15-8-14-10/h2-3,6,8H,1,4-5,7,13H2,(H,14,15) |
| InChIKey | HEVPRVWCXAXUAT-UHFFFAOYSA-N |
| XLogP | 1.94 |
| TPSA | 54.70 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 201.27 |
| LogP ≤ 5 | 1.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |