C7H5F3N2O2 — CID 82610184
5-amino-6-(trifluoromethyl)pyridine-2-carboxylic acid (PubChem CID 82610184) has the molecular formula C7H5F3N2O2 and a molecular weight of 206.12 g/mol. Its IUPAC name is 5-amino-6-(trifluoromethyl)pyridine-2-carboxylic acid.
| Compound Name | 5-amino-6-(trifluoromethyl)pyridine-2-carboxylic acid |
|---|---|
| PubChem CID | 82610184 |
| Molecular Formula | C7H5F3N2O2 |
| Molecular Weight | 206.12 g/mol |
| Exact Mass | 206.03 |
| IUPAC Name | 5-amino-6-(trifluoromethyl)pyridine-2-carboxylic acid |
| SMILES | Nc1ccc(C(=O)O)nc1C(F)(F)F |
| InChI | InChI=1S/C7H5F3N2O2/c8-7(9,10)5-3(11)1-2-4(12-5)6(13)14/h1-2H,11H2,(H,13,14) |
| InChIKey | KAFOIYXOXOVGPO-UHFFFAOYSA-N |
| XLogP | 1.38 |
| TPSA | 76.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.12 |
| LogP ≤ 5 | 1.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |