C12H16FNO — CID 82612123
2-[1-(aminomethyl)cyclopentyl]-4-fluorophenol (PubChem CID 82612123) has the molecular formula C12H16FNO and a molecular weight of 209.26 g/mol. Its IUPAC name is 2-[1-(aminomethyl)cyclopentyl]-4-fluorophenol.
| Compound Name | 2-[1-(aminomethyl)cyclopentyl]-4-fluorophenol |
|---|---|
| PubChem CID | 82612123 |
| Molecular Formula | C12H16FNO |
| Molecular Weight | 209.26 g/mol |
| Exact Mass | 209.12 |
| IUPAC Name | 2-[1-(aminomethyl)cyclopentyl]-4-fluorophenol |
| SMILES | NCC1(c2cc(F)ccc2O)CCCC1 |
| InChI | InChI=1S/C12H16FNO/c13-9-3-4-11(15)10(7-9)12(8-14)5-1-2-6-12/h3-4,7,15H,1-2,5-6,8,14H2 |
| InChIKey | WNPCOTKCTWKZND-UHFFFAOYSA-N |
| XLogP | 2.30 |
| TPSA | 46.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 209.26 |
| LogP ≤ 5 | 2.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |