About 1-methyl-7-piperazin-1-yl-2,3-dihydroindole
1-methyl-7-piperazin-1-yl-2,3-dihydroindole (PubChem CID 82614660) has the molecular formula C13H19N3
and a molecular weight of 217.32 g/mol. Its IUPAC name is 1-methyl-7-piperazin-1-yl-2,3-dihydroindole.
Molecular Properties
| Compound Name | 1-methyl-7-piperazin-1-yl-2,3-dihydroindole |
| PubChem CID | 82614660 |
| Molecular Formula | C13H19N3 |
| Molecular Weight | 217.32 g/mol |
| Exact Mass | 217.16 |
| IUPAC Name | 1-methyl-7-piperazin-1-yl-2,3-dihydroindole |
| SMILES | CN1CCc2cccc(N3CCNCC3)c21 |
| InChI | InChI=1S/C13H19N3/c1-15-8-5-11-3-2-4-12(13(11)15)16-9-6-14-7-10-16/h2-4,14H,5-10H2,1H3 |
| InChIKey | YOJBMQGCJJFIEZ-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 18.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 217.32 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-methyl-7-piperazin-1-yl-2,3-dihydroindole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-methyl-7-piperazin-1-yl-2,3-dihydroindole?
The IUPAC name of 1-methyl-7-piperazin-1-yl-2,3-dihydroindole (CID 82614660) is 1-methyl-7-piperazin-1-yl-2,3-dihydroindole.
What is the SMILES notation for 1-methyl-7-piperazin-1-yl-2,3-dihydroindole?
The canonical SMILES for 1-methyl-7-piperazin-1-yl-2,3-dihydroindole is CN1CCc2cccc(N3CCNCC3)c21.
What is the InChIKey of 1-methyl-7-piperazin-1-yl-2,3-dihydroindole?
The InChIKey is YOJBMQGCJJFIEZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H19N3/c1-15-8-5-11-3-2-4-12(13(11)15)16-9-6-14-7-10-16/h2-4,14H,5-10H2,1H3.
What are the key properties of 1-methyl-7-piperazin-1-yl-2,3-dihydroindole?
1-methyl-7-piperazin-1-yl-2,3-dihydroindole has a molecular weight of 217.32 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-methyl-7-piperazin-1-yl-2,3-dihydroindole is sourced from PubChem (CID 82614660), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).