About 7-piperidin-4-yl-1,3-benzothiazole
7-piperidin-4-yl-1,3-benzothiazole (PubChem CID 82615244) has the molecular formula C12H14N2S
and a molecular weight of 218.32 g/mol. Its IUPAC name is 7-piperidin-4-yl-1,3-benzothiazole.
Molecular Properties
| Compound Name | 7-piperidin-4-yl-1,3-benzothiazole |
| PubChem CID | 82615244 |
| Molecular Formula | C12H14N2S |
| Molecular Weight | 218.32 g/mol |
| Exact Mass | 218.09 |
| IUPAC Name | 7-piperidin-4-yl-1,3-benzothiazole |
| SMILES | c1cc(C2CCNCC2)c2scnc2c1 |
| InChI | InChI=1S/C12H14N2S/c1-2-10(9-4-6-13-7-5-9)12-11(3-1)14-8-15-12/h1-3,8-9,13H,4-7H2 |
| InChIKey | XZAKWJISJBPSFH-UHFFFAOYSA-N |
| XLogP | 2.76 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 218.32 |
| LogP ≤ 5 | 2.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 7-piperidin-4-yl-1,3-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-piperidin-4-yl-1,3-benzothiazole?
The IUPAC name of 7-piperidin-4-yl-1,3-benzothiazole (CID 82615244) is 7-piperidin-4-yl-1,3-benzothiazole.
What is the SMILES notation for 7-piperidin-4-yl-1,3-benzothiazole?
The canonical SMILES for 7-piperidin-4-yl-1,3-benzothiazole is c1cc(C2CCNCC2)c2scnc2c1.
What is the InChIKey of 7-piperidin-4-yl-1,3-benzothiazole?
The InChIKey is XZAKWJISJBPSFH-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14N2S/c1-2-10(9-4-6-13-7-5-9)12-11(3-1)14-8-15-12/h1-3,8-9,13H,4-7H2.
What are the key properties of 7-piperidin-4-yl-1,3-benzothiazole?
7-piperidin-4-yl-1,3-benzothiazole has a molecular weight of 218.32 g/mol, XLogP of 2.76, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 7-piperidin-4-yl-1,3-benzothiazole is sourced from PubChem (CID 82615244), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).