About 6-piperazin-1-yl-1,2-benzothiazole
6-piperazin-1-yl-1,2-benzothiazole (PubChem CID 82615929) has the molecular formula C11H13N3S
and a molecular weight of 219.31 g/mol. Its IUPAC name is 6-piperazin-1-yl-1,2-benzothiazole.
Molecular Properties
| Compound Name | 6-piperazin-1-yl-1,2-benzothiazole |
| PubChem CID | 82615929 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 6-piperazin-1-yl-1,2-benzothiazole |
| SMILES | c1cc2cnsc2cc1N1CCNCC1 |
| InChI | InChI=1S/C11H13N3S/c1-2-10(14-5-3-12-4-6-14)7-11-9(1)8-13-15-11/h1-2,7-8,12H,3-6H2 |
| InChIKey | FXNLNOLMMYQYBG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 6-piperazin-1-yl-1,2-benzothiazole with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-piperazin-1-yl-1,2-benzothiazole?
The IUPAC name of 6-piperazin-1-yl-1,2-benzothiazole (CID 82615929) is 6-piperazin-1-yl-1,2-benzothiazole.
What is the SMILES notation for 6-piperazin-1-yl-1,2-benzothiazole?
The canonical SMILES for 6-piperazin-1-yl-1,2-benzothiazole is c1cc2cnsc2cc1N1CCNCC1.
What is the InChIKey of 6-piperazin-1-yl-1,2-benzothiazole?
The InChIKey is FXNLNOLMMYQYBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H13N3S/c1-2-10(14-5-3-12-4-6-14)7-11-9(1)8-13-15-11/h1-2,7-8,12H,3-6H2.
What are the key properties of 6-piperazin-1-yl-1,2-benzothiazole?
6-piperazin-1-yl-1,2-benzothiazole has a molecular weight of 219.31 g/mol, XLogP of 1.71, 1 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 6-piperazin-1-yl-1,2-benzothiazole is sourced from PubChem (CID 82615929), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).