C11H13N3S — CID 82615929
6-piperazin-1-yl-1,2-benzothiazole (PubChem CID 82615929) has the molecular formula C11H13N3S and a molecular weight of 219.31 g/mol. Its IUPAC name is 6-piperazin-1-yl-1,2-benzothiazole.
| Compound Name | 6-piperazin-1-yl-1,2-benzothiazole |
|---|---|
| PubChem CID | 82615929 |
| Molecular Formula | C11H13N3S |
| Molecular Weight | 219.31 g/mol |
| Exact Mass | 219.08 |
| IUPAC Name | 6-piperazin-1-yl-1,2-benzothiazole |
| SMILES | c1cc2cnsc2cc1N1CCNCC1 |
| InChI | InChI=1S/C11H13N3S/c1-2-10(14-5-3-12-4-6-14)7-11-9(1)8-13-15-11/h1-2,7-8,12H,3-6H2 |
| InChIKey | FXNLNOLMMYQYBG-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 28.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.31 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |