About 7-bromo-1-methyl-3,4-dihydro-2H-quinoline
7-bromo-1-methyl-3,4-dihydro-2H-quinoline (PubChem CID 82618152) has the molecular formula C10H12BrN
and a molecular weight of 226.12 g/mol. Its IUPAC name is 7-bromo-1-methyl-3,4-dihydro-2H-quinoline.
Molecular Properties
| Compound Name | 7-bromo-1-methyl-3,4-dihydro-2H-quinoline |
| PubChem CID | 82618152 |
| Molecular Formula | C10H12BrN |
| Molecular Weight | 226.12 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | 7-bromo-1-methyl-3,4-dihydro-2H-quinoline |
| SMILES | CN1CCCc2ccc(Br)cc21 |
| InChI | InChI=1S/C10H12BrN/c1-12-6-2-3-8-4-5-9(11)7-10(8)12/h4-5,7H,2-3,6H2,1H3 |
| InChIKey | FFZJBJFSFZZSCQ-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 3.24 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.12 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 7-bromo-1-methyl-3,4-dihydro-2H-quinoline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-bromo-1-methyl-3,4-dihydro-2H-quinoline?
The IUPAC name of 7-bromo-1-methyl-3,4-dihydro-2H-quinoline (CID 82618152) is 7-bromo-1-methyl-3,4-dihydro-2H-quinoline.
What is the SMILES notation for 7-bromo-1-methyl-3,4-dihydro-2H-quinoline?
The canonical SMILES for 7-bromo-1-methyl-3,4-dihydro-2H-quinoline is CN1CCCc2ccc(Br)cc21.
What is the InChIKey of 7-bromo-1-methyl-3,4-dihydro-2H-quinoline?
The InChIKey is FFZJBJFSFZZSCQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H12BrN/c1-12-6-2-3-8-4-5-9(11)7-10(8)12/h4-5,7H,2-3,6H2,1H3.
What are the key properties of 7-bromo-1-methyl-3,4-dihydro-2H-quinoline?
7-bromo-1-methyl-3,4-dihydro-2H-quinoline has a molecular weight of 226.12 g/mol, XLogP of 2.83, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 7-bromo-1-methyl-3,4-dihydro-2H-quinoline is sourced from PubChem (CID 82618152), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).