About ethyl 3-amino-5-nitrobenzoate
ethyl 3-amino-5-nitrobenzoate (PubChem CID 826201) has the molecular formula C9H10N2O4
and a molecular weight of 210.19 g/mol. Its IUPAC name is ethyl 3-amino-5-nitrobenzoate.
Molecular Properties
| Compound Name | ethyl 3-amino-5-nitrobenzoate |
| PubChem CID | 826201 |
| Molecular Formula | C9H10N2O4 |
| Molecular Weight | 210.19 g/mol |
| Exact Mass | 210.06 |
| IUPAC Name | ethyl 3-amino-5-nitrobenzoate |
| SMILES | CCOC(=O)c1cc(N)cc([N+](=O)[O-])c1 |
| InChI | InChI=1S/C9H10N2O4/c1-2-15-9(12)6-3-7(10)5-8(4-6)11(13)14/h3-5H,2,10H2,1H3 |
| InChIKey | DJOFAKOEQNUEAK-UHFFFAOYSA-N |
| XLogP | 1.35 |
| TPSA | 95.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 210.19 |
| LogP ≤ 5 | 1.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze ethyl 3-amino-5-nitrobenzoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-amino-5-nitrobenzoate?
The IUPAC name of ethyl 3-amino-5-nitrobenzoate (CID 826201) is ethyl 3-amino-5-nitrobenzoate.
What is the SMILES notation for ethyl 3-amino-5-nitrobenzoate?
The canonical SMILES for ethyl 3-amino-5-nitrobenzoate is CCOC(=O)c1cc(N)cc([N+](=O)[O-])c1.
What is the InChIKey of ethyl 3-amino-5-nitrobenzoate?
The InChIKey is DJOFAKOEQNUEAK-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H10N2O4/c1-2-15-9(12)6-3-7(10)5-8(4-6)11(13)14/h3-5H,2,10H2,1H3.
What are the key properties of ethyl 3-amino-5-nitrobenzoate?
ethyl 3-amino-5-nitrobenzoate has a molecular weight of 210.19 g/mol, XLogP of 1.35, 3 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-amino-5-nitrobenzoate is sourced from PubChem (CID 826201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).