C11H15N3OS — CID 82621344
2-(3-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,4-oxazepane (PubChem CID 82621344) has the molecular formula C11H15N3OS and a molecular weight of 237.33 g/mol. Its IUPAC name is 2-(3-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,4-oxazepane.
| Compound Name | 2-(3-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,4-oxazepane |
|---|---|
| PubChem CID | 82621344 |
| Molecular Formula | C11H15N3OS |
| Molecular Weight | 237.33 g/mol |
| Exact Mass | 237.09 |
| IUPAC Name | 2-(3-methylimidazo[2,1-b][1,3]thiazol-5-yl)-1,4-oxazepane |
| SMILES | Cc1csc2ncc(C3CNCCCO3)n12 |
| InChI | InChI=1S/C11H15N3OS/c1-8-7-16-11-13-5-9(14(8)11)10-6-12-3-2-4-15-10/h5,7,10,12H,2-4,6H2,1H3 |
| InChIKey | QTJDTSKVOGIIFG-UHFFFAOYSA-N |
| XLogP | 1.76 |
| TPSA | 38.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 237.33 |
| LogP ≤ 5 | 1.76 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |