About (3-bromothieno[3,2-b]pyridin-2-yl)methanamine
(3-bromothieno[3,2-b]pyridin-2-yl)methanamine (PubChem CID 82622236) has the molecular formula C8H7BrN2S
and a molecular weight of 243.13 g/mol. Its IUPAC name is (3-bromothieno[3,2-b]pyridin-2-yl)methanamine.
Molecular Properties
| Compound Name | (3-bromothieno[3,2-b]pyridin-2-yl)methanamine |
| PubChem CID | 82622236 |
| Molecular Formula | C8H7BrN2S |
| Molecular Weight | 243.13 g/mol |
| Exact Mass | 241.95 |
| IUPAC Name | (3-bromothieno[3,2-b]pyridin-2-yl)methanamine |
| SMILES | NCc1sc2cccnc2c1Br |
| InChI | InChI=1S/C8H7BrN2S/c9-7-6(4-10)12-5-2-1-3-11-8(5)7/h1-3H,4,10H2 |
| InChIKey | QMIKZVYHRBOFLR-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 38.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 243.13 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze (3-bromothieno[3,2-b]pyridin-2-yl)methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (3-bromothieno[3,2-b]pyridin-2-yl)methanamine?
The IUPAC name of (3-bromothieno[3,2-b]pyridin-2-yl)methanamine (CID 82622236) is (3-bromothieno[3,2-b]pyridin-2-yl)methanamine.
What is the SMILES notation for (3-bromothieno[3,2-b]pyridin-2-yl)methanamine?
The canonical SMILES for (3-bromothieno[3,2-b]pyridin-2-yl)methanamine is NCc1sc2cccnc2c1Br.
What is the InChIKey of (3-bromothieno[3,2-b]pyridin-2-yl)methanamine?
The InChIKey is QMIKZVYHRBOFLR-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7BrN2S/c9-7-6(4-10)12-5-2-1-3-11-8(5)7/h1-3H,4,10H2.
What are the key properties of (3-bromothieno[3,2-b]pyridin-2-yl)methanamine?
(3-bromothieno[3,2-b]pyridin-2-yl)methanamine has a molecular weight of 243.13 g/mol, XLogP of 2.52, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (3-bromothieno[3,2-b]pyridin-2-yl)methanamine is sourced from PubChem (CID 82622236), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).