C11H19N7 — CID 826227
[4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-propan-2-ylcyanamide (PubChem CID 826227) has the molecular formula C11H19N7 and a molecular weight of 249.32 g/mol. Its IUPAC name is [4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-propan-2-ylcyanamide.
| Compound Name | [4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-propan-2-ylcyanamide |
|---|---|
| PubChem CID | 826227 |
| Molecular Formula | C11H19N7 |
| Molecular Weight | 249.32 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | [4,6-bis(ethylamino)-1,3,5-triazin-2-yl]-propan-2-ylcyanamide |
| SMILES | CCNc1nc(NCC)nc(N(C#N)C(C)C)n1 |
| InChI | InChI=1S/C11H19N7/c1-5-13-9-15-10(14-6-2)17-11(16-9)18(7-12)8(3)4/h8H,5-6H2,1-4H3,(H2,13,14,15,16,17) |
| InChIKey | QTGJUTUHXZTTFT-UHFFFAOYSA-N |
| XLogP | 1.43 |
| TPSA | 89.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.32 |
| LogP ≤ 5 | 1.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'}, {'alert_name': 'enamine', 'substructure': 'N/A'} |
|---|