About 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid
3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid (PubChem CID 82624156) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid.
Molecular Properties
| Compound Name | 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid |
| PubChem CID | 82624156 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid |
| SMILES | Nc1c(C2CCCC2)nc2c(c1C(=O)O)CCOC2 |
| InChI | InChI=1S/C14H18N2O3/c15-12-11(14(17)18)9-5-6-19-7-10(9)16-13(12)8-3-1-2-4-8/h8H,1-7,15H2,(H,17,18) |
| InChIKey | INQDXGLICQYELJ-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 85.44 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid?
The IUPAC name of 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid (CID 82624156) is 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid.
What is the SMILES notation for 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid?
The canonical SMILES for 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid is Nc1c(C2CCCC2)nc2c(c1C(=O)O)CCOC2.
What is the InChIKey of 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid?
The InChIKey is INQDXGLICQYELJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c15-12-11(14(17)18)9-5-6-19-7-10(9)16-13(12)8-3-1-2-4-8/h8H,1-7,15H2,(H,17,18).
What are the key properties of 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid?
3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid has a molecular weight of 262.31 g/mol, XLogP of 2.09, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 3-amino-2-cyclopentyl-6,8-dihydro-5H-pyrano[3,4-b]pyridine-4-carboxylic acid is sourced from PubChem (CID 82624156), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).