About 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid
1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid (PubChem CID 82624167) has the molecular formula C14H18N2O3
and a molecular weight of 262.31 g/mol. Its IUPAC name is 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid.
Molecular Properties
| Compound Name | 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid |
| PubChem CID | 82624167 |
| Molecular Formula | C14H18N2O3 |
| Molecular Weight | 262.31 g/mol |
| Exact Mass | 262.13 |
| IUPAC Name | 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid |
| SMILES | CC(=O)N1CC(N)(C(=O)O)Cc2c(C)ccc(C)c21 |
| InChI | InChI=1S/C14H18N2O3/c1-8-4-5-9(2)12-11(8)6-14(15,13(18)19)7-16(12)10(3)17/h4-5H,6-7,15H2,1-3H3,(H,18,19) |
| InChIKey | KMEXCMAPSCMGQB-UHFFFAOYSA-N |
| XLogP | 0.99 |
| TPSA | 83.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.31 |
| LogP ≤ 5 | 0.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid?
The IUPAC name of 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid (CID 82624167) is 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid.
What is the SMILES notation for 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid?
The canonical SMILES for 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid is CC(=O)N1CC(N)(C(=O)O)Cc2c(C)ccc(C)c21.
What is the InChIKey of 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid?
The InChIKey is KMEXCMAPSCMGQB-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H18N2O3/c1-8-4-5-9(2)12-11(8)6-14(15,13(18)19)7-16(12)10(3)17/h4-5H,6-7,15H2,1-3H3,(H,18,19).
What are the key properties of 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid?
1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid has a molecular weight of 262.31 g/mol, XLogP of 0.99, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-acetyl-3-amino-5,8-dimethyl-2,4-dihydroquinoline-3-carboxylic acid is sourced from PubChem (CID 82624167), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).