About 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one
7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one (PubChem CID 82624852) has the molecular formula C12H15N3O4
and a molecular weight of 265.27 g/mol. Its IUPAC name is 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one.
Molecular Properties
| Compound Name | 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one |
| PubChem CID | 82624852 |
| Molecular Formula | C12H15N3O4 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one |
| SMILES | COc1cc(OC)n2c(=O)c(CCO)c(C)nc2n1 |
| InChI | InChI=1S/C12H15N3O4/c1-7-8(4-5-16)11(17)15-10(19-3)6-9(18-2)14-12(15)13-7/h6,16H,4-5H2,1-3H3 |
| InChIKey | GFEOBNXVDJMIPG-UHFFFAOYSA-N |
| XLogP | -0.05 |
| TPSA | 85.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | -0.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
Analyze 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one?
The IUPAC name of 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one (CID 82624852) is 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one.
What is the SMILES notation for 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one?
The canonical SMILES for 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one is COc1cc(OC)n2c(=O)c(CCO)c(C)nc2n1.
What is the InChIKey of 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one?
The InChIKey is GFEOBNXVDJMIPG-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H15N3O4/c1-7-8(4-5-16)11(17)15-10(19-3)6-9(18-2)14-12(15)13-7/h6,16H,4-5H2,1-3H3.
What are the key properties of 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one?
7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one has a molecular weight of 265.27 g/mol, XLogP of -0.05, 4 rotatable bonds, 1 hydrogen bond donors, and 7 hydrogen bond acceptors.
Where does this data come from?
All data for 7-(2-hydroxyethyl)-2,4-dimethoxy-8-methylpyrimido[1,2-a]pyrimidin-6-one is sourced from PubChem (CID 82624852), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).