C14H16FNO3 — CID 82624854
tert-butyl 6-fluoro-5-formyl-2,3-dihydroindole-1-carboxylate (PubChem CID 82624854) has the molecular formula C14H16FNO3 and a molecular weight of 265.28 g/mol. Its IUPAC name is tert-butyl 6-fluoro-5-formyl-2,3-dihydroindole-1-carboxylate.
| Compound Name | tert-butyl 6-fluoro-5-formyl-2,3-dihydroindole-1-carboxylate |
|---|---|
| PubChem CID | 82624854 |
| Molecular Formula | C14H16FNO3 |
| Molecular Weight | 265.28 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | tert-butyl 6-fluoro-5-formyl-2,3-dihydroindole-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCc2cc(C=O)c(F)cc21 |
| InChI | InChI=1S/C14H16FNO3/c1-14(2,3)19-13(18)16-5-4-9-6-10(8-17)11(15)7-12(9)16/h6-8H,4-5H2,1-3H3 |
| InChIKey | OWQAOQQSEZKYNL-UHFFFAOYSA-N |
| XLogP | 2.94 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.28 |
| LogP ≤ 5 | 2.94 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|