About 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine]
6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine] (PubChem CID 82625302) has the molecular formula C12H14BrNO
and a molecular weight of 268.15 g/mol. Its IUPAC name is 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine].
Molecular Properties
| Compound Name | 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine] |
| PubChem CID | 82625302 |
| Molecular Formula | C12H14BrNO |
| Molecular Weight | 268.15 g/mol |
| Exact Mass | 267.03 |
| IUPAC Name | 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine] |
| SMILES | Brc1ccc2c(c1)C1(CCNC1)CCO2 |
| InChI | InChI=1S/C12H14BrNO/c13-9-1-2-11-10(7-9)12(4-6-15-11)3-5-14-8-12/h1-2,7,14H,3-6,8H2 |
| InChIKey | NWZSAXZOCORESO-UHFFFAOYSA-N |
| XLogP | 2.46 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.15 |
| LogP ≤ 5 | 2.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine] with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine]?
The IUPAC name of 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine] (CID 82625302) is 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine].
What is the SMILES notation for 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine]?
The canonical SMILES for 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine] is Brc1ccc2c(c1)C1(CCNC1)CCO2.
What is the InChIKey of 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine]?
The InChIKey is NWZSAXZOCORESO-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H14BrNO/c13-9-1-2-11-10(7-9)12(4-6-15-11)3-5-14-8-12/h1-2,7,14H,3-6,8H2.
What are the key properties of 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine]?
6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine] has a molecular weight of 268.15 g/mol, XLogP of 2.46, 0 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 6-bromospiro[2,3-dihydrochromene-4,3'-pyrrolidine] is sourced from PubChem (CID 82625302), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).