About 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid
4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid (PubChem CID 82625377) has the molecular formula C13H17ClN2O2
and a molecular weight of 268.74 g/mol. Its IUPAC name is 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid.
Molecular Properties
| Compound Name | 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid |
| PubChem CID | 82625377 |
| Molecular Formula | C13H17ClN2O2 |
| Molecular Weight | 268.74 g/mol |
| Exact Mass | 268.10 |
| IUPAC Name | 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid |
| SMILES | Cc1c(Cl)ccc2c1N(C)CCC(N)(C(=O)O)C2 |
| InChI | InChI=1S/C13H17ClN2O2/c1-8-10(14)4-3-9-7-13(15,12(17)18)5-6-16(2)11(8)9/h3-4H,5-7,15H2,1-2H3,(H,17,18) |
| InChIKey | XNPYWQSFDQCJPT-UHFFFAOYSA-N |
| XLogP | 1.81 |
| TPSA | 66.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 268.74 |
| LogP ≤ 5 | 1.81 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid?
The IUPAC name of 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid (CID 82625377) is 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid.
What is the SMILES notation for 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid?
The canonical SMILES for 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid is Cc1c(Cl)ccc2c1N(C)CCC(N)(C(=O)O)C2.
What is the InChIKey of 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid?
The InChIKey is XNPYWQSFDQCJPT-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H17ClN2O2/c1-8-10(14)4-3-9-7-13(15,12(17)18)5-6-16(2)11(8)9/h3-4H,5-7,15H2,1-2H3,(H,17,18).
What are the key properties of 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid?
4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid has a molecular weight of 268.74 g/mol, XLogP of 1.81, 1 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-amino-8-chloro-1,9-dimethyl-3,5-dihydro-2H-1-benzazepine-4-carboxylic acid is sourced from PubChem (CID 82625377), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).