About 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone
1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone (PubChem CID 82625906) has the molecular formula C17H24N2O
and a molecular weight of 272.39 g/mol. Its IUPAC name is 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone |
| PubChem CID | 82625906 |
| Molecular Formula | C17H24N2O |
| Molecular Weight | 272.39 g/mol |
| Exact Mass | 272.19 |
| IUPAC Name | 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone |
| SMILES | CCc1cccc2c1N(C(C)=O)CCC1(CCNC1)C2 |
| InChI | InChI=1S/C17H24N2O/c1-3-14-5-4-6-15-11-17(7-9-18-12-17)8-10-19(13(2)20)16(14)15/h4-6,18H,3,7-12H2,1-2H3 |
| InChIKey | TXODYTGNWHOGBB-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 272.39 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone?
The IUPAC name of 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone (CID 82625906) is 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone.
What is the SMILES notation for 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone?
The canonical SMILES for 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone is CCc1cccc2c1N(C(C)=O)CCC1(CCNC1)C2.
What is the InChIKey of 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone?
The InChIKey is TXODYTGNWHOGBB-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H24N2O/c1-3-14-5-4-6-15-11-17(7-9-18-12-17)8-10-19(13(2)20)16(14)15/h4-6,18H,3,7-12H2,1-2H3.
What are the key properties of 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone?
1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone has a molecular weight of 272.39 g/mol, XLogP of 2.53, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-ethylspiro[3,5-dihydro-2H-1-benzazepine-4,3'-pyrrolidine]-1-yl)ethanone is sourced from PubChem (CID 82625906), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).