About 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone
1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone (PubChem CID 82626141) has the molecular formula C16H22N2O2
and a molecular weight of 274.36 g/mol. Its IUPAC name is 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone.
Molecular Properties
| Compound Name | 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone |
| PubChem CID | 82626141 |
| Molecular Formula | C16H22N2O2 |
| Molecular Weight | 274.36 g/mol |
| Exact Mass | 274.17 |
| IUPAC Name | 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone |
| SMILES | COc1cccc2c1N(C(C)=O)CCCC21CCNC1 |
| InChI | InChI=1S/C16H22N2O2/c1-12(19)18-10-4-7-16(8-9-17-11-16)13-5-3-6-14(20-2)15(13)18/h3,5-6,17H,4,7-11H2,1-2H3 |
| InChIKey | QOMORDFPWUCCNW-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 274.36 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone?
The IUPAC name of 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone (CID 82626141) is 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone.
What is the SMILES notation for 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone?
The canonical SMILES for 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone is COc1cccc2c1N(C(C)=O)CCCC21CCNC1.
What is the InChIKey of 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone?
The InChIKey is QOMORDFPWUCCNW-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22N2O2/c1-12(19)18-10-4-7-16(8-9-17-11-16)13-5-3-6-14(20-2)15(13)18/h3,5-6,17H,4,7-11H2,1-2H3.
What are the key properties of 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone?
1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone has a molecular weight of 274.36 g/mol, XLogP of 2.07, 1 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(9-methoxyspiro[3,4-dihydro-2H-1-benzazepine-5,3'-pyrrolidine]-1-yl)ethanone is sourced from PubChem (CID 82626141), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).