About 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one
1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one (PubChem CID 82626314) has the molecular formula C16H21NOS
and a molecular weight of 275.42 g/mol. Its IUPAC name is 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one.
Molecular Properties
| Compound Name | 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one |
| PubChem CID | 82626314 |
| Molecular Formula | C16H21NOS |
| Molecular Weight | 275.42 g/mol |
| Exact Mass | 275.13 |
| IUPAC Name | 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one |
| SMILES | CCC(=O)c1ccc2c(c1)C1(CCCS2)CCNC1 |
| InChI | InChI=1S/C16H21NOS/c1-2-14(18)12-4-5-15-13(10-12)16(6-3-9-19-15)7-8-17-11-16/h4-5,10,17H,2-3,6-9,11H2,1H3 |
| InChIKey | OFCOCJGFTULSCU-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 29.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 275.42 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one?
The IUPAC name of 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one (CID 82626314) is 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one.
What is the SMILES notation for 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one?
The canonical SMILES for 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one is CCC(=O)c1ccc2c(c1)C1(CCCS2)CCNC1.
What is the InChIKey of 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one?
The InChIKey is OFCOCJGFTULSCU-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H21NOS/c1-2-14(18)12-4-5-15-13(10-12)16(6-3-9-19-15)7-8-17-11-16/h4-5,10,17H,2-3,6-9,11H2,1H3.
What are the key properties of 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one?
1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one has a molecular weight of 275.42 g/mol, XLogP of 3.40, 2 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 1-spiro[3,4-dihydro-2H-1-benzothiepine-5,3'-pyrrolidine]-7-ylpropan-1-one is sourced from PubChem (CID 82626314), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).