C12H12N4OS2 — CID 826364
14,14-dimethyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione (PubChem CID 826364) has the molecular formula C12H12N4OS2 and a molecular weight of 292.39 g/mol. Its IUPAC name is 14,14-dimethyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione.
| Compound Name | 14,14-dimethyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione |
|---|---|
| PubChem CID | 826364 |
| Molecular Formula | C12H12N4OS2 |
| Molecular Weight | 292.39 g/mol |
| Exact Mass | 292.05 |
| IUPAC Name | 14,14-dimethyl-13-oxa-10-thia-3,4,6,8-tetrazatetracyclo[7.7.0.02,6.011,16]hexadeca-1(9),2,7,11(16)-tetraene-5-thione |
| SMILES | CC1(C)Cc2c(sc3ncn4c(=S)[nH]nc4c23)CO1 |
| InChI | InChI=1S/C12H12N4OS2/c1-12(2)3-6-7(4-17-12)19-10-8(6)9-14-15-11(18)16(9)5-13-10/h5H,3-4H2,1-2H3,(H,15,18) |
| InChIKey | LJNYIGHLJRFYGD-UHFFFAOYSA-N |
| XLogP | 2.85 |
| TPSA | 55.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.39 |
| LogP ≤ 5 | 2.85 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|