1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid

C12H13NO3 — CID 82647171

IUPAC1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid
SMILESCCN1C(=O)CC(C(=O)O)c2ccccc21
InChIInChI=1S/C12H13NO3/c1-2-13-10-6-4-3-5-8(10)9(12(15)16)7-11(13)14/h3-6,9H,2,7H2,1H3,(H,15,16)
InChIKeyRUPAQYPRJBHCQF-UHFFFAOYSA-N
MW219.24 g/mol
LogP1.61
Rot. Bonds2

About 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid

1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid (PubChem CID 82647171) has the molecular formula C12H13NO3 and a molecular weight of 219.24 g/mol. Its IUPAC name is 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid.

Molecular Properties

Compound Name1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid
PubChem CID82647171
Molecular FormulaC12H13NO3
Molecular Weight219.24 g/mol
Exact Mass219.09
IUPAC Name1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid
SMILESCCN1C(=O)CC(C(=O)O)c2ccccc21
InChIInChI=1S/C12H13NO3/c1-2-13-10-6-4-3-5-8(10)9(12(15)16)7-11(13)14/h3-6,9H,2,7H2,1H3,(H,15,16)
InChIKeyRUPAQYPRJBHCQF-UHFFFAOYSA-N
XLogP1.61
TPSA57.61 Ų
H-Bond Donors1
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms16
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500219.24
LogP ≤ 51.61
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 102

Analyze 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid?
The IUPAC name of 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid (CID 82647171) is 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid.
What is the SMILES notation for 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid?
The canonical SMILES for 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid is CCN1C(=O)CC(C(=O)O)c2ccccc21.
What is the InChIKey of 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid?
The InChIKey is RUPAQYPRJBHCQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H13NO3/c1-2-13-10-6-4-3-5-8(10)9(12(15)16)7-11(13)14/h3-6,9H,2,7H2,1H3,(H,15,16).
What are the key properties of 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid?
1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid has a molecular weight of 219.24 g/mol, XLogP of 1.61, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-ethyl-2-oxo-3,4-dihydroquinoline-4-carboxylic acid is sourced from PubChem (CID 82647171), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).