About 6-amino-2H-imidazo[1,5-a]pyridin-3-one
6-amino-2H-imidazo[1,5-a]pyridin-3-one (PubChem CID 82647185) has the molecular formula C7H7N3O
and a molecular weight of 149.15 g/mol. Its IUPAC name is 6-amino-2H-imidazo[1,5-a]pyridin-3-one.
Molecular Properties
| Compound Name | 6-amino-2H-imidazo[1,5-a]pyridin-3-one |
| PubChem CID | 82647185 |
| Molecular Formula | C7H7N3O |
| Molecular Weight | 149.15 g/mol |
| Exact Mass | 149.06 |
| IUPAC Name | 6-amino-2H-imidazo[1,5-a]pyridin-3-one |
| SMILES | Nc1ccc2c[nH]c(=O)n2c1 |
| InChI | InChI=1S/C7H7N3O/c8-5-1-2-6-3-9-7(11)10(6)4-5/h1-4H,8H2,(H,9,11) |
| InChIKey | JFYMSMNLXAUNHJ-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 63.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 149.15 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 6-amino-2H-imidazo[1,5-a]pyridin-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 6-amino-2H-imidazo[1,5-a]pyridin-3-one?
The IUPAC name of 6-amino-2H-imidazo[1,5-a]pyridin-3-one (CID 82647185) is 6-amino-2H-imidazo[1,5-a]pyridin-3-one.
What is the SMILES notation for 6-amino-2H-imidazo[1,5-a]pyridin-3-one?
The canonical SMILES for 6-amino-2H-imidazo[1,5-a]pyridin-3-one is Nc1ccc2c[nH]c(=O)n2c1.
What is the InChIKey of 6-amino-2H-imidazo[1,5-a]pyridin-3-one?
The InChIKey is JFYMSMNLXAUNHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H7N3O/c8-5-1-2-6-3-9-7(11)10(6)4-5/h1-4H,8H2,(H,9,11).
What are the key properties of 6-amino-2H-imidazo[1,5-a]pyridin-3-one?
6-amino-2H-imidazo[1,5-a]pyridin-3-one has a molecular weight of 149.15 g/mol, XLogP of 0.21, 0 rotatable bonds, 2 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 6-amino-2H-imidazo[1,5-a]pyridin-3-one is sourced from PubChem (CID 82647185), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).