About 4-benzhydryloxythiane
4-benzhydryloxythiane (PubChem CID 826489) has the molecular formula C18H20OS
and a molecular weight of 284.42 g/mol. Its IUPAC name is 4-benzhydryloxythiane.
Molecular Properties
| Compound Name | 4-benzhydryloxythiane |
| PubChem CID | 826489 |
| Molecular Formula | C18H20OS |
| Molecular Weight | 284.42 g/mol |
| Exact Mass | 284.12 |
| IUPAC Name | 4-benzhydryloxythiane |
| SMILES | c1ccc(C(OC2CCSCC2)c2ccccc2)cc1 |
| InChI | InChI=1S/C18H20OS/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)19-17-11-13-20-14-12-17/h1-10,17-18H,11-14H2 |
| InChIKey | OKFUYNIXBWECQY-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 284.42 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-benzhydryloxythiane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-benzhydryloxythiane?
The IUPAC name of 4-benzhydryloxythiane (CID 826489) is 4-benzhydryloxythiane.
What is the SMILES notation for 4-benzhydryloxythiane?
The canonical SMILES for 4-benzhydryloxythiane is c1ccc(C(OC2CCSCC2)c2ccccc2)cc1.
What is the InChIKey of 4-benzhydryloxythiane?
The InChIKey is OKFUYNIXBWECQY-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H20OS/c1-3-7-15(8-4-1)18(16-9-5-2-6-10-16)19-17-11-13-20-14-12-17/h1-10,17-18H,11-14H2.
What are the key properties of 4-benzhydryloxythiane?
4-benzhydryloxythiane has a molecular weight of 284.42 g/mol, XLogP of 4.69, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-benzhydryloxythiane is sourced from PubChem (CID 826489), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).