About 1,5-dimethyl-1,2,4-triazole-3-carbonitrile
1,5-dimethyl-1,2,4-triazole-3-carbonitrile (PubChem CID 82650969) has the molecular formula C5H6N4
and a molecular weight of 122.13 g/mol. Its IUPAC name is 1,5-dimethyl-1,2,4-triazole-3-carbonitrile.
Molecular Properties
| Compound Name | 1,5-dimethyl-1,2,4-triazole-3-carbonitrile |
| PubChem CID | 82650969 |
| Molecular Formula | C5H6N4 |
| Molecular Weight | 122.13 g/mol |
| Exact Mass | 122.06 |
| IUPAC Name | 1,5-dimethyl-1,2,4-triazole-3-carbonitrile |
| SMILES | Cc1nc(C#N)nn1C |
| InChI | InChI=1S/C5H6N4/c1-4-7-5(3-6)8-9(4)2/h1-2H3 |
| InChIKey | NFRPZRQUCFTDOC-UHFFFAOYSA-N |
| XLogP | -0.00 |
| TPSA | 54.50 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.13 |
| LogP ≤ 5 | -0.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 1,5-dimethyl-1,2,4-triazole-3-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,5-dimethyl-1,2,4-triazole-3-carbonitrile?
The IUPAC name of 1,5-dimethyl-1,2,4-triazole-3-carbonitrile (CID 82650969) is 1,5-dimethyl-1,2,4-triazole-3-carbonitrile.
What is the SMILES notation for 1,5-dimethyl-1,2,4-triazole-3-carbonitrile?
The canonical SMILES for 1,5-dimethyl-1,2,4-triazole-3-carbonitrile is Cc1nc(C#N)nn1C.
What is the InChIKey of 1,5-dimethyl-1,2,4-triazole-3-carbonitrile?
The InChIKey is NFRPZRQUCFTDOC-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H6N4/c1-4-7-5(3-6)8-9(4)2/h1-2H3.
What are the key properties of 1,5-dimethyl-1,2,4-triazole-3-carbonitrile?
1,5-dimethyl-1,2,4-triazole-3-carbonitrile has a molecular weight of 122.13 g/mol, XLogP of -0.00, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1,5-dimethyl-1,2,4-triazole-3-carbonitrile is sourced from PubChem (CID 82650969), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).